|
|
|
package chain
|
|
|
|
|
|
|
|
import (
|
|
|
|
"bytes"
|
[rpc][availability][apr] Richer validator information, implement APR, unify EPoS computation, remove fall 2019 tech debt (#2484)
* [rpc][validator] Extend hmy blockchain validator information
* [availability] Optimize bump count
* [staking][validator][rpc] Remove validator stats rpc, fold into validator information, make existing pattern default behavior
* [slash] Reimplement SetDifference
* [reward][engine][network] Remove bad API from fall, begin setup for Per validator awards
* [header] Custom Marshal header for downstream, remove dev code
* [effective][committee] Factor out EPoS round of computation thereby unification in codebase of EPoS
* [unit-test] Fix semantically wrong validator unit tests, punt on maxBLS key wrt tx-pool test
* [reward] Use excellent singleflight package for caching lookup of subcommittees
* [apr][reward] Begin APR package itself, iterate on iterface signatures
* [reward] Handle possible error from singleflight
* [rpc][validator][reward] Adjust RPC committees, singleflight on votingPower, foldStats into Validator Information
* [apr] Stub out computation of APR
* [effective][committee] Upgrade SlotPurchase with named fields, provide marshal
* [effective] Update Tests
* [blockchain] TODO Remove the validators no longer in committee
* [validator][effective] More expressive string representation of eligibilty, ValidatorRPC explicit say if in committee now
* [rpc] Median-stake more semantic meaningful
* [validator] Iterate on semantic meaning of JSON representation
* [offchain] Make validator stats return explicit error
* [availability] Small typo
* [rpc] Quick visual hack until fix delete out kicked out validators
* [offchain] Delete validator from offchain that lost their slot
* [apr] Forgot to update interface signature
* [apr] Mul instead of Div
* [protocol][validator] Fold block reward accum per vaidator into validator-wrapper, off-chain => on-chain
* [votepower] Refactor votepower Roster, simplify aggregation of network wide rosters
* [votepower][shard] Adjust roster, optimize usage of BLSPublicKey as key, use MarshalText trick
* [shard] Granular errors
* [votepower][validator] Unify votepower data structure with off-chain usage
* [votepower][consensus][validator] Further simplify and unify votepower with off-chain, validator stats
* [votepower] Use RJs naming convention group,overall
* [votepower] Remove Println, do keep enforcing order
* [effective][reward] Expand semantics of eligibility as it was overloaded and confusing, evict old voting power computations
* [apr] Adjust json field name
* [votepower] Only aggregate on external validator
* [votepower] Mistake on aggregation, custom presentation network-wide
* [rpc][validator][availability] Remove parameter, take into account empty snapshot
* [apr] Use snapshots from two, one epochs ago. Still have question on header
* [apr] Use GetHeaderByNumber for the header needed for time stamp
* [chain] Evict > 3 epoch old voting power
* [blockchain] Leave Delete Validator snapshot as TODO
* [validator][rpc][effective] Undo changes to Protocol field, use virtual construct at RPC layer for meaning
* [project] Address PR comments
* [committee][rpc] Move +1 to computation of epos round rather than hack mutation
* [reward] Remove entire unnecessary loop, hook on AddReward. Remove unnecessary new big int
* [votepower][rpc][validator] Stick with numeric.Dec for token involved with computation, expose accumulate block-reward in RPC
* [effective][committee] Track the candidates for the EPoS auction, RPC median-stake benefits
* [node] Add hack way to get real error reason of why cannot load shardchain
* [consensus] Expand log on current issue on nil block
* [apr] Do the actual call to compute for validator's APR
* [committee] Wrap SlotOrder with validator address, manifests in median-stake RPC
* [apr] Incorrect error handle order
* [quorum] Remove incorrect compare on bls Key, (typo), remove redundant error check
* [shard] Add log if stakedSlots is 0
* [apr] More sanity check on div by zero, more lenient on error when dont have historical data yet
* [committee] Remove + 1 on seat count
* [apr] Use int64() directly
* [apr] Log when odd empty nil header
* [apr] Do not crash on empty header, figure out later
5 years ago
|
|
|
"fmt"
|
|
|
|
"math/big"
|
|
|
|
"sort"
|
|
|
|
"time"
|
|
|
|
|
|
|
|
"github.com/harmony-one/harmony/internal/params"
|
|
|
|
lru "github.com/hashicorp/golang-lru"
|
|
|
|
|
|
|
|
"github.com/harmony-one/harmony/numeric"
|
|
|
|
types2 "github.com/harmony-one/harmony/staking/types"
|
|
|
|
|
|
|
|
"github.com/ethereum/go-ethereum/common"
|
|
|
|
"github.com/ethereum/go-ethereum/rlp"
|
|
|
|
"github.com/harmony-one/harmony/block"
|
|
|
|
"github.com/harmony-one/harmony/consensus/engine"
|
|
|
|
"github.com/harmony-one/harmony/consensus/reward"
|
|
|
|
"github.com/harmony-one/harmony/consensus/votepower"
|
|
|
|
"github.com/harmony-one/harmony/core/state"
|
|
|
|
"github.com/harmony-one/harmony/core/types"
|
|
|
|
"github.com/harmony-one/harmony/internal/utils"
|
|
|
|
"github.com/harmony-one/harmony/shard"
|
|
|
|
"github.com/harmony-one/harmony/staking/availability"
|
|
|
|
"github.com/harmony-one/harmony/staking/network"
|
|
|
|
stakingReward "github.com/harmony-one/harmony/staking/reward"
|
|
|
|
"github.com/pkg/errors"
|
|
|
|
)
|
|
|
|
|
|
|
|
// timeout constant
|
|
|
|
const (
|
|
|
|
// AsyncBlockProposalTimeout is the timeout which will abort the async block proposal.
|
|
|
|
AsyncBlockProposalTimeout = 9 * time.Second
|
|
|
|
// RewardFrequency the number of blocks between each aggregated reward distribution
|
|
|
|
RewardFrequency = 64
|
|
|
|
)
|
|
|
|
|
|
|
|
type slotPayable struct {
|
|
|
|
shard.Slot
|
|
|
|
payout *big.Int
|
|
|
|
bucket int
|
|
|
|
index int
|
|
|
|
shardID uint32
|
|
|
|
}
|
|
|
|
|
|
|
|
type slotMissing struct {
|
|
|
|
shard.Slot
|
|
|
|
bucket int
|
|
|
|
index int
|
|
|
|
}
|
|
|
|
|
|
|
|
func ballotResultBeaconchain(
|
|
|
|
bc engine.ChainReader, header *block.Header,
|
|
|
|
) (*big.Int, shard.SlotList, shard.SlotList, shard.SlotList, error) {
|
|
|
|
parentHeader := bc.GetHeaderByHash(header.ParentHash())
|
|
|
|
if parentHeader == nil {
|
|
|
|
return nil, nil, nil, nil, errors.Errorf(
|
|
|
|
"cannot find parent block header in DB %s",
|
|
|
|
header.ParentHash().Hex(),
|
|
|
|
)
|
|
|
|
}
|
|
|
|
parentShardState, err := bc.ReadShardState(parentHeader.Epoch())
|
|
|
|
if err != nil {
|
|
|
|
return nil, nil, nil, nil, errors.Errorf(
|
|
|
|
"cannot read shard state %v", parentHeader.Epoch(),
|
|
|
|
)
|
|
|
|
}
|
|
|
|
|
|
|
|
members, payable, missing, err :=
|
|
|
|
availability.BallotResult(parentHeader, header, parentShardState, shard.BeaconChainShardID)
|
|
|
|
return parentHeader.Epoch(), members, payable, missing, err
|
|
|
|
}
|
|
|
|
|
[rpc][availability][apr] Richer validator information, implement APR, unify EPoS computation, remove fall 2019 tech debt (#2484)
* [rpc][validator] Extend hmy blockchain validator information
* [availability] Optimize bump count
* [staking][validator][rpc] Remove validator stats rpc, fold into validator information, make existing pattern default behavior
* [slash] Reimplement SetDifference
* [reward][engine][network] Remove bad API from fall, begin setup for Per validator awards
* [header] Custom Marshal header for downstream, remove dev code
* [effective][committee] Factor out EPoS round of computation thereby unification in codebase of EPoS
* [unit-test] Fix semantically wrong validator unit tests, punt on maxBLS key wrt tx-pool test
* [reward] Use excellent singleflight package for caching lookup of subcommittees
* [apr][reward] Begin APR package itself, iterate on iterface signatures
* [reward] Handle possible error from singleflight
* [rpc][validator][reward] Adjust RPC committees, singleflight on votingPower, foldStats into Validator Information
* [apr] Stub out computation of APR
* [effective][committee] Upgrade SlotPurchase with named fields, provide marshal
* [effective] Update Tests
* [blockchain] TODO Remove the validators no longer in committee
* [validator][effective] More expressive string representation of eligibilty, ValidatorRPC explicit say if in committee now
* [rpc] Median-stake more semantic meaningful
* [validator] Iterate on semantic meaning of JSON representation
* [offchain] Make validator stats return explicit error
* [availability] Small typo
* [rpc] Quick visual hack until fix delete out kicked out validators
* [offchain] Delete validator from offchain that lost their slot
* [apr] Forgot to update interface signature
* [apr] Mul instead of Div
* [protocol][validator] Fold block reward accum per vaidator into validator-wrapper, off-chain => on-chain
* [votepower] Refactor votepower Roster, simplify aggregation of network wide rosters
* [votepower][shard] Adjust roster, optimize usage of BLSPublicKey as key, use MarshalText trick
* [shard] Granular errors
* [votepower][validator] Unify votepower data structure with off-chain usage
* [votepower][consensus][validator] Further simplify and unify votepower with off-chain, validator stats
* [votepower] Use RJs naming convention group,overall
* [votepower] Remove Println, do keep enforcing order
* [effective][reward] Expand semantics of eligibility as it was overloaded and confusing, evict old voting power computations
* [apr] Adjust json field name
* [votepower] Only aggregate on external validator
* [votepower] Mistake on aggregation, custom presentation network-wide
* [rpc][validator][availability] Remove parameter, take into account empty snapshot
* [apr] Use snapshots from two, one epochs ago. Still have question on header
* [apr] Use GetHeaderByNumber for the header needed for time stamp
* [chain] Evict > 3 epoch old voting power
* [blockchain] Leave Delete Validator snapshot as TODO
* [validator][rpc][effective] Undo changes to Protocol field, use virtual construct at RPC layer for meaning
* [project] Address PR comments
* [committee][rpc] Move +1 to computation of epos round rather than hack mutation
* [reward] Remove entire unnecessary loop, hook on AddReward. Remove unnecessary new big int
* [votepower][rpc][validator] Stick with numeric.Dec for token involved with computation, expose accumulate block-reward in RPC
* [effective][committee] Track the candidates for the EPoS auction, RPC median-stake benefits
* [node] Add hack way to get real error reason of why cannot load shardchain
* [consensus] Expand log on current issue on nil block
* [apr] Do the actual call to compute for validator's APR
* [committee] Wrap SlotOrder with validator address, manifests in median-stake RPC
* [apr] Incorrect error handle order
* [quorum] Remove incorrect compare on bls Key, (typo), remove redundant error check
* [shard] Add log if stakedSlots is 0
* [apr] More sanity check on div by zero, more lenient on error when dont have historical data yet
* [committee] Remove + 1 on seat count
* [apr] Use int64() directly
* [apr] Log when odd empty nil header
* [apr] Do not crash on empty header, figure out later
5 years ago
|
|
|
var (
|
|
|
|
votingPowerCache, _ = lru.New(16)
|
|
|
|
delegateShareCache, _ = lru.New(1024)
|
[rpc][availability][apr] Richer validator information, implement APR, unify EPoS computation, remove fall 2019 tech debt (#2484)
* [rpc][validator] Extend hmy blockchain validator information
* [availability] Optimize bump count
* [staking][validator][rpc] Remove validator stats rpc, fold into validator information, make existing pattern default behavior
* [slash] Reimplement SetDifference
* [reward][engine][network] Remove bad API from fall, begin setup for Per validator awards
* [header] Custom Marshal header for downstream, remove dev code
* [effective][committee] Factor out EPoS round of computation thereby unification in codebase of EPoS
* [unit-test] Fix semantically wrong validator unit tests, punt on maxBLS key wrt tx-pool test
* [reward] Use excellent singleflight package for caching lookup of subcommittees
* [apr][reward] Begin APR package itself, iterate on iterface signatures
* [reward] Handle possible error from singleflight
* [rpc][validator][reward] Adjust RPC committees, singleflight on votingPower, foldStats into Validator Information
* [apr] Stub out computation of APR
* [effective][committee] Upgrade SlotPurchase with named fields, provide marshal
* [effective] Update Tests
* [blockchain] TODO Remove the validators no longer in committee
* [validator][effective] More expressive string representation of eligibilty, ValidatorRPC explicit say if in committee now
* [rpc] Median-stake more semantic meaningful
* [validator] Iterate on semantic meaning of JSON representation
* [offchain] Make validator stats return explicit error
* [availability] Small typo
* [rpc] Quick visual hack until fix delete out kicked out validators
* [offchain] Delete validator from offchain that lost their slot
* [apr] Forgot to update interface signature
* [apr] Mul instead of Div
* [protocol][validator] Fold block reward accum per vaidator into validator-wrapper, off-chain => on-chain
* [votepower] Refactor votepower Roster, simplify aggregation of network wide rosters
* [votepower][shard] Adjust roster, optimize usage of BLSPublicKey as key, use MarshalText trick
* [shard] Granular errors
* [votepower][validator] Unify votepower data structure with off-chain usage
* [votepower][consensus][validator] Further simplify and unify votepower with off-chain, validator stats
* [votepower] Use RJs naming convention group,overall
* [votepower] Remove Println, do keep enforcing order
* [effective][reward] Expand semantics of eligibility as it was overloaded and confusing, evict old voting power computations
* [apr] Adjust json field name
* [votepower] Only aggregate on external validator
* [votepower] Mistake on aggregation, custom presentation network-wide
* [rpc][validator][availability] Remove parameter, take into account empty snapshot
* [apr] Use snapshots from two, one epochs ago. Still have question on header
* [apr] Use GetHeaderByNumber for the header needed for time stamp
* [chain] Evict > 3 epoch old voting power
* [blockchain] Leave Delete Validator snapshot as TODO
* [validator][rpc][effective] Undo changes to Protocol field, use virtual construct at RPC layer for meaning
* [project] Address PR comments
* [committee][rpc] Move +1 to computation of epos round rather than hack mutation
* [reward] Remove entire unnecessary loop, hook on AddReward. Remove unnecessary new big int
* [votepower][rpc][validator] Stick with numeric.Dec for token involved with computation, expose accumulate block-reward in RPC
* [effective][committee] Track the candidates for the EPoS auction, RPC median-stake benefits
* [node] Add hack way to get real error reason of why cannot load shardchain
* [consensus] Expand log on current issue on nil block
* [apr] Do the actual call to compute for validator's APR
* [committee] Wrap SlotOrder with validator address, manifests in median-stake RPC
* [apr] Incorrect error handle order
* [quorum] Remove incorrect compare on bls Key, (typo), remove redundant error check
* [shard] Add log if stakedSlots is 0
* [apr] More sanity check on div by zero, more lenient on error when dont have historical data yet
* [committee] Remove + 1 on seat count
* [apr] Use int64() directly
* [apr] Log when odd empty nil header
* [apr] Do not crash on empty header, figure out later
5 years ago
|
|
|
)
|
|
|
|
|
|
|
|
func lookupVotingPower(
|
|
|
|
epoch *big.Int, subComm *shard.Committee,
|
[rpc][availability][apr] Richer validator information, implement APR, unify EPoS computation, remove fall 2019 tech debt (#2484)
* [rpc][validator] Extend hmy blockchain validator information
* [availability] Optimize bump count
* [staking][validator][rpc] Remove validator stats rpc, fold into validator information, make existing pattern default behavior
* [slash] Reimplement SetDifference
* [reward][engine][network] Remove bad API from fall, begin setup for Per validator awards
* [header] Custom Marshal header for downstream, remove dev code
* [effective][committee] Factor out EPoS round of computation thereby unification in codebase of EPoS
* [unit-test] Fix semantically wrong validator unit tests, punt on maxBLS key wrt tx-pool test
* [reward] Use excellent singleflight package for caching lookup of subcommittees
* [apr][reward] Begin APR package itself, iterate on iterface signatures
* [reward] Handle possible error from singleflight
* [rpc][validator][reward] Adjust RPC committees, singleflight on votingPower, foldStats into Validator Information
* [apr] Stub out computation of APR
* [effective][committee] Upgrade SlotPurchase with named fields, provide marshal
* [effective] Update Tests
* [blockchain] TODO Remove the validators no longer in committee
* [validator][effective] More expressive string representation of eligibilty, ValidatorRPC explicit say if in committee now
* [rpc] Median-stake more semantic meaningful
* [validator] Iterate on semantic meaning of JSON representation
* [offchain] Make validator stats return explicit error
* [availability] Small typo
* [rpc] Quick visual hack until fix delete out kicked out validators
* [offchain] Delete validator from offchain that lost their slot
* [apr] Forgot to update interface signature
* [apr] Mul instead of Div
* [protocol][validator] Fold block reward accum per vaidator into validator-wrapper, off-chain => on-chain
* [votepower] Refactor votepower Roster, simplify aggregation of network wide rosters
* [votepower][shard] Adjust roster, optimize usage of BLSPublicKey as key, use MarshalText trick
* [shard] Granular errors
* [votepower][validator] Unify votepower data structure with off-chain usage
* [votepower][consensus][validator] Further simplify and unify votepower with off-chain, validator stats
* [votepower] Use RJs naming convention group,overall
* [votepower] Remove Println, do keep enforcing order
* [effective][reward] Expand semantics of eligibility as it was overloaded and confusing, evict old voting power computations
* [apr] Adjust json field name
* [votepower] Only aggregate on external validator
* [votepower] Mistake on aggregation, custom presentation network-wide
* [rpc][validator][availability] Remove parameter, take into account empty snapshot
* [apr] Use snapshots from two, one epochs ago. Still have question on header
* [apr] Use GetHeaderByNumber for the header needed for time stamp
* [chain] Evict > 3 epoch old voting power
* [blockchain] Leave Delete Validator snapshot as TODO
* [validator][rpc][effective] Undo changes to Protocol field, use virtual construct at RPC layer for meaning
* [project] Address PR comments
* [committee][rpc] Move +1 to computation of epos round rather than hack mutation
* [reward] Remove entire unnecessary loop, hook on AddReward. Remove unnecessary new big int
* [votepower][rpc][validator] Stick with numeric.Dec for token involved with computation, expose accumulate block-reward in RPC
* [effective][committee] Track the candidates for the EPoS auction, RPC median-stake benefits
* [node] Add hack way to get real error reason of why cannot load shardchain
* [consensus] Expand log on current issue on nil block
* [apr] Do the actual call to compute for validator's APR
* [committee] Wrap SlotOrder with validator address, manifests in median-stake RPC
* [apr] Incorrect error handle order
* [quorum] Remove incorrect compare on bls Key, (typo), remove redundant error check
* [shard] Add log if stakedSlots is 0
* [apr] More sanity check on div by zero, more lenient on error when dont have historical data yet
* [committee] Remove + 1 on seat count
* [apr] Use int64() directly
* [apr] Log when odd empty nil header
* [apr] Do not crash on empty header, figure out later
5 years ago
|
|
|
) (*votepower.Roster, error) {
|
|
|
|
// Look up
|
[rpc][availability][apr] Richer validator information, implement APR, unify EPoS computation, remove fall 2019 tech debt (#2484)
* [rpc][validator] Extend hmy blockchain validator information
* [availability] Optimize bump count
* [staking][validator][rpc] Remove validator stats rpc, fold into validator information, make existing pattern default behavior
* [slash] Reimplement SetDifference
* [reward][engine][network] Remove bad API from fall, begin setup for Per validator awards
* [header] Custom Marshal header for downstream, remove dev code
* [effective][committee] Factor out EPoS round of computation thereby unification in codebase of EPoS
* [unit-test] Fix semantically wrong validator unit tests, punt on maxBLS key wrt tx-pool test
* [reward] Use excellent singleflight package for caching lookup of subcommittees
* [apr][reward] Begin APR package itself, iterate on iterface signatures
* [reward] Handle possible error from singleflight
* [rpc][validator][reward] Adjust RPC committees, singleflight on votingPower, foldStats into Validator Information
* [apr] Stub out computation of APR
* [effective][committee] Upgrade SlotPurchase with named fields, provide marshal
* [effective] Update Tests
* [blockchain] TODO Remove the validators no longer in committee
* [validator][effective] More expressive string representation of eligibilty, ValidatorRPC explicit say if in committee now
* [rpc] Median-stake more semantic meaningful
* [validator] Iterate on semantic meaning of JSON representation
* [offchain] Make validator stats return explicit error
* [availability] Small typo
* [rpc] Quick visual hack until fix delete out kicked out validators
* [offchain] Delete validator from offchain that lost their slot
* [apr] Forgot to update interface signature
* [apr] Mul instead of Div
* [protocol][validator] Fold block reward accum per vaidator into validator-wrapper, off-chain => on-chain
* [votepower] Refactor votepower Roster, simplify aggregation of network wide rosters
* [votepower][shard] Adjust roster, optimize usage of BLSPublicKey as key, use MarshalText trick
* [shard] Granular errors
* [votepower][validator] Unify votepower data structure with off-chain usage
* [votepower][consensus][validator] Further simplify and unify votepower with off-chain, validator stats
* [votepower] Use RJs naming convention group,overall
* [votepower] Remove Println, do keep enforcing order
* [effective][reward] Expand semantics of eligibility as it was overloaded and confusing, evict old voting power computations
* [apr] Adjust json field name
* [votepower] Only aggregate on external validator
* [votepower] Mistake on aggregation, custom presentation network-wide
* [rpc][validator][availability] Remove parameter, take into account empty snapshot
* [apr] Use snapshots from two, one epochs ago. Still have question on header
* [apr] Use GetHeaderByNumber for the header needed for time stamp
* [chain] Evict > 3 epoch old voting power
* [blockchain] Leave Delete Validator snapshot as TODO
* [validator][rpc][effective] Undo changes to Protocol field, use virtual construct at RPC layer for meaning
* [project] Address PR comments
* [committee][rpc] Move +1 to computation of epos round rather than hack mutation
* [reward] Remove entire unnecessary loop, hook on AddReward. Remove unnecessary new big int
* [votepower][rpc][validator] Stick with numeric.Dec for token involved with computation, expose accumulate block-reward in RPC
* [effective][committee] Track the candidates for the EPoS auction, RPC median-stake benefits
* [node] Add hack way to get real error reason of why cannot load shardchain
* [consensus] Expand log on current issue on nil block
* [apr] Do the actual call to compute for validator's APR
* [committee] Wrap SlotOrder with validator address, manifests in median-stake RPC
* [apr] Incorrect error handle order
* [quorum] Remove incorrect compare on bls Key, (typo), remove redundant error check
* [shard] Add log if stakedSlots is 0
* [apr] More sanity check on div by zero, more lenient on error when dont have historical data yet
* [committee] Remove + 1 on seat count
* [apr] Use int64() directly
* [apr] Log when odd empty nil header
* [apr] Do not crash on empty header, figure out later
5 years ago
|
|
|
key := fmt.Sprintf("%s-%d", epoch.String(), subComm.ShardID)
|
|
|
|
if b, ok := votingPowerCache.Get(key); ok {
|
|
|
|
return b.(*votepower.Roster), nil
|
|
|
|
}
|
|
|
|
|
|
|
|
// If not found, construct
|
|
|
|
votingPower, err := votepower.Compute(subComm, epoch)
|
[rpc][availability][apr] Richer validator information, implement APR, unify EPoS computation, remove fall 2019 tech debt (#2484)
* [rpc][validator] Extend hmy blockchain validator information
* [availability] Optimize bump count
* [staking][validator][rpc] Remove validator stats rpc, fold into validator information, make existing pattern default behavior
* [slash] Reimplement SetDifference
* [reward][engine][network] Remove bad API from fall, begin setup for Per validator awards
* [header] Custom Marshal header for downstream, remove dev code
* [effective][committee] Factor out EPoS round of computation thereby unification in codebase of EPoS
* [unit-test] Fix semantically wrong validator unit tests, punt on maxBLS key wrt tx-pool test
* [reward] Use excellent singleflight package for caching lookup of subcommittees
* [apr][reward] Begin APR package itself, iterate on iterface signatures
* [reward] Handle possible error from singleflight
* [rpc][validator][reward] Adjust RPC committees, singleflight on votingPower, foldStats into Validator Information
* [apr] Stub out computation of APR
* [effective][committee] Upgrade SlotPurchase with named fields, provide marshal
* [effective] Update Tests
* [blockchain] TODO Remove the validators no longer in committee
* [validator][effective] More expressive string representation of eligibilty, ValidatorRPC explicit say if in committee now
* [rpc] Median-stake more semantic meaningful
* [validator] Iterate on semantic meaning of JSON representation
* [offchain] Make validator stats return explicit error
* [availability] Small typo
* [rpc] Quick visual hack until fix delete out kicked out validators
* [offchain] Delete validator from offchain that lost their slot
* [apr] Forgot to update interface signature
* [apr] Mul instead of Div
* [protocol][validator] Fold block reward accum per vaidator into validator-wrapper, off-chain => on-chain
* [votepower] Refactor votepower Roster, simplify aggregation of network wide rosters
* [votepower][shard] Adjust roster, optimize usage of BLSPublicKey as key, use MarshalText trick
* [shard] Granular errors
* [votepower][validator] Unify votepower data structure with off-chain usage
* [votepower][consensus][validator] Further simplify and unify votepower with off-chain, validator stats
* [votepower] Use RJs naming convention group,overall
* [votepower] Remove Println, do keep enforcing order
* [effective][reward] Expand semantics of eligibility as it was overloaded and confusing, evict old voting power computations
* [apr] Adjust json field name
* [votepower] Only aggregate on external validator
* [votepower] Mistake on aggregation, custom presentation network-wide
* [rpc][validator][availability] Remove parameter, take into account empty snapshot
* [apr] Use snapshots from two, one epochs ago. Still have question on header
* [apr] Use GetHeaderByNumber for the header needed for time stamp
* [chain] Evict > 3 epoch old voting power
* [blockchain] Leave Delete Validator snapshot as TODO
* [validator][rpc][effective] Undo changes to Protocol field, use virtual construct at RPC layer for meaning
* [project] Address PR comments
* [committee][rpc] Move +1 to computation of epos round rather than hack mutation
* [reward] Remove entire unnecessary loop, hook on AddReward. Remove unnecessary new big int
* [votepower][rpc][validator] Stick with numeric.Dec for token involved with computation, expose accumulate block-reward in RPC
* [effective][committee] Track the candidates for the EPoS auction, RPC median-stake benefits
* [node] Add hack way to get real error reason of why cannot load shardchain
* [consensus] Expand log on current issue on nil block
* [apr] Do the actual call to compute for validator's APR
* [committee] Wrap SlotOrder with validator address, manifests in median-stake RPC
* [apr] Incorrect error handle order
* [quorum] Remove incorrect compare on bls Key, (typo), remove redundant error check
* [shard] Add log if stakedSlots is 0
* [apr] More sanity check on div by zero, more lenient on error when dont have historical data yet
* [committee] Remove + 1 on seat count
* [apr] Use int64() directly
* [apr] Log when odd empty nil header
* [apr] Do not crash on empty header, figure out later
5 years ago
|
|
|
if err != nil {
|
|
|
|
return nil, err
|
|
|
|
}
|
|
|
|
|
|
|
|
// Put in cache
|
|
|
|
votingPowerCache.Add(key, votingPower)
|
|
|
|
return votingPower, nil
|
|
|
|
}
|
|
|
|
|
|
|
|
// Lookup or compute the shares of stake for all delegators in a validator
|
|
|
|
func lookupDelegatorShares(
|
|
|
|
snapshot *types2.ValidatorSnapshot,
|
|
|
|
) (map[common.Address]numeric.Dec, error) {
|
|
|
|
epoch := snapshot.Epoch
|
|
|
|
validatorSnapshot := snapshot.Validator
|
|
|
|
|
|
|
|
// Look up
|
|
|
|
key := fmt.Sprintf("%s-%s", epoch.String(), validatorSnapshot.Address.Hex())
|
|
|
|
|
|
|
|
if b, ok := delegateShareCache.Get(key); ok {
|
|
|
|
return b.(map[common.Address]numeric.Dec), nil
|
|
|
|
}
|
|
|
|
|
|
|
|
// If not found, construct
|
|
|
|
result := map[common.Address]numeric.Dec{}
|
|
|
|
|
|
|
|
totalDelegationDec := numeric.NewDecFromBigInt(validatorSnapshot.TotalDelegation())
|
|
|
|
if totalDelegationDec.IsZero() {
|
|
|
|
utils.Logger().Info().
|
|
|
|
RawJSON("validator-snapshot", []byte(validatorSnapshot.String())).
|
|
|
|
Msg("zero total delegation during AddReward delegation payout")
|
|
|
|
return result, nil
|
|
|
|
}
|
|
|
|
|
|
|
|
for i := range validatorSnapshot.Delegations {
|
|
|
|
delegation := validatorSnapshot.Delegations[i]
|
|
|
|
// NOTE percentage = <this_delegator_amount>/<total_delegation>
|
|
|
|
percentage := numeric.NewDecFromBigInt(delegation.Amount).Quo(totalDelegationDec)
|
|
|
|
result[delegation.DelegatorAddress] = percentage
|
[rpc][availability][apr] Richer validator information, implement APR, unify EPoS computation, remove fall 2019 tech debt (#2484)
* [rpc][validator] Extend hmy blockchain validator information
* [availability] Optimize bump count
* [staking][validator][rpc] Remove validator stats rpc, fold into validator information, make existing pattern default behavior
* [slash] Reimplement SetDifference
* [reward][engine][network] Remove bad API from fall, begin setup for Per validator awards
* [header] Custom Marshal header for downstream, remove dev code
* [effective][committee] Factor out EPoS round of computation thereby unification in codebase of EPoS
* [unit-test] Fix semantically wrong validator unit tests, punt on maxBLS key wrt tx-pool test
* [reward] Use excellent singleflight package for caching lookup of subcommittees
* [apr][reward] Begin APR package itself, iterate on iterface signatures
* [reward] Handle possible error from singleflight
* [rpc][validator][reward] Adjust RPC committees, singleflight on votingPower, foldStats into Validator Information
* [apr] Stub out computation of APR
* [effective][committee] Upgrade SlotPurchase with named fields, provide marshal
* [effective] Update Tests
* [blockchain] TODO Remove the validators no longer in committee
* [validator][effective] More expressive string representation of eligibilty, ValidatorRPC explicit say if in committee now
* [rpc] Median-stake more semantic meaningful
* [validator] Iterate on semantic meaning of JSON representation
* [offchain] Make validator stats return explicit error
* [availability] Small typo
* [rpc] Quick visual hack until fix delete out kicked out validators
* [offchain] Delete validator from offchain that lost their slot
* [apr] Forgot to update interface signature
* [apr] Mul instead of Div
* [protocol][validator] Fold block reward accum per vaidator into validator-wrapper, off-chain => on-chain
* [votepower] Refactor votepower Roster, simplify aggregation of network wide rosters
* [votepower][shard] Adjust roster, optimize usage of BLSPublicKey as key, use MarshalText trick
* [shard] Granular errors
* [votepower][validator] Unify votepower data structure with off-chain usage
* [votepower][consensus][validator] Further simplify and unify votepower with off-chain, validator stats
* [votepower] Use RJs naming convention group,overall
* [votepower] Remove Println, do keep enforcing order
* [effective][reward] Expand semantics of eligibility as it was overloaded and confusing, evict old voting power computations
* [apr] Adjust json field name
* [votepower] Only aggregate on external validator
* [votepower] Mistake on aggregation, custom presentation network-wide
* [rpc][validator][availability] Remove parameter, take into account empty snapshot
* [apr] Use snapshots from two, one epochs ago. Still have question on header
* [apr] Use GetHeaderByNumber for the header needed for time stamp
* [chain] Evict > 3 epoch old voting power
* [blockchain] Leave Delete Validator snapshot as TODO
* [validator][rpc][effective] Undo changes to Protocol field, use virtual construct at RPC layer for meaning
* [project] Address PR comments
* [committee][rpc] Move +1 to computation of epos round rather than hack mutation
* [reward] Remove entire unnecessary loop, hook on AddReward. Remove unnecessary new big int
* [votepower][rpc][validator] Stick with numeric.Dec for token involved with computation, expose accumulate block-reward in RPC
* [effective][committee] Track the candidates for the EPoS auction, RPC median-stake benefits
* [node] Add hack way to get real error reason of why cannot load shardchain
* [consensus] Expand log on current issue on nil block
* [apr] Do the actual call to compute for validator's APR
* [committee] Wrap SlotOrder with validator address, manifests in median-stake RPC
* [apr] Incorrect error handle order
* [quorum] Remove incorrect compare on bls Key, (typo), remove redundant error check
* [shard] Add log if stakedSlots is 0
* [apr] More sanity check on div by zero, more lenient on error when dont have historical data yet
* [committee] Remove + 1 on seat count
* [apr] Use int64() directly
* [apr] Log when odd empty nil header
* [apr] Do not crash on empty header, figure out later
5 years ago
|
|
|
}
|
|
|
|
|
|
|
|
// Put in cache
|
|
|
|
delegateShareCache.Add(key, result)
|
|
|
|
return result, nil
|
[rpc][availability][apr] Richer validator information, implement APR, unify EPoS computation, remove fall 2019 tech debt (#2484)
* [rpc][validator] Extend hmy blockchain validator information
* [availability] Optimize bump count
* [staking][validator][rpc] Remove validator stats rpc, fold into validator information, make existing pattern default behavior
* [slash] Reimplement SetDifference
* [reward][engine][network] Remove bad API from fall, begin setup for Per validator awards
* [header] Custom Marshal header for downstream, remove dev code
* [effective][committee] Factor out EPoS round of computation thereby unification in codebase of EPoS
* [unit-test] Fix semantically wrong validator unit tests, punt on maxBLS key wrt tx-pool test
* [reward] Use excellent singleflight package for caching lookup of subcommittees
* [apr][reward] Begin APR package itself, iterate on iterface signatures
* [reward] Handle possible error from singleflight
* [rpc][validator][reward] Adjust RPC committees, singleflight on votingPower, foldStats into Validator Information
* [apr] Stub out computation of APR
* [effective][committee] Upgrade SlotPurchase with named fields, provide marshal
* [effective] Update Tests
* [blockchain] TODO Remove the validators no longer in committee
* [validator][effective] More expressive string representation of eligibilty, ValidatorRPC explicit say if in committee now
* [rpc] Median-stake more semantic meaningful
* [validator] Iterate on semantic meaning of JSON representation
* [offchain] Make validator stats return explicit error
* [availability] Small typo
* [rpc] Quick visual hack until fix delete out kicked out validators
* [offchain] Delete validator from offchain that lost their slot
* [apr] Forgot to update interface signature
* [apr] Mul instead of Div
* [protocol][validator] Fold block reward accum per vaidator into validator-wrapper, off-chain => on-chain
* [votepower] Refactor votepower Roster, simplify aggregation of network wide rosters
* [votepower][shard] Adjust roster, optimize usage of BLSPublicKey as key, use MarshalText trick
* [shard] Granular errors
* [votepower][validator] Unify votepower data structure with off-chain usage
* [votepower][consensus][validator] Further simplify and unify votepower with off-chain, validator stats
* [votepower] Use RJs naming convention group,overall
* [votepower] Remove Println, do keep enforcing order
* [effective][reward] Expand semantics of eligibility as it was overloaded and confusing, evict old voting power computations
* [apr] Adjust json field name
* [votepower] Only aggregate on external validator
* [votepower] Mistake on aggregation, custom presentation network-wide
* [rpc][validator][availability] Remove parameter, take into account empty snapshot
* [apr] Use snapshots from two, one epochs ago. Still have question on header
* [apr] Use GetHeaderByNumber for the header needed for time stamp
* [chain] Evict > 3 epoch old voting power
* [blockchain] Leave Delete Validator snapshot as TODO
* [validator][rpc][effective] Undo changes to Protocol field, use virtual construct at RPC layer for meaning
* [project] Address PR comments
* [committee][rpc] Move +1 to computation of epos round rather than hack mutation
* [reward] Remove entire unnecessary loop, hook on AddReward. Remove unnecessary new big int
* [votepower][rpc][validator] Stick with numeric.Dec for token involved with computation, expose accumulate block-reward in RPC
* [effective][committee] Track the candidates for the EPoS auction, RPC median-stake benefits
* [node] Add hack way to get real error reason of why cannot load shardchain
* [consensus] Expand log on current issue on nil block
* [apr] Do the actual call to compute for validator's APR
* [committee] Wrap SlotOrder with validator address, manifests in median-stake RPC
* [apr] Incorrect error handle order
* [quorum] Remove incorrect compare on bls Key, (typo), remove redundant error check
* [shard] Add log if stakedSlots is 0
* [apr] More sanity check on div by zero, more lenient on error when dont have historical data yet
* [committee] Remove + 1 on seat count
* [apr] Use int64() directly
* [apr] Log when odd empty nil header
* [apr] Do not crash on empty header, figure out later
5 years ago
|
|
|
}
|
|
|
|
|
|
|
|
// Handle block rewards during pre-staking era
|
|
|
|
func accumulateRewardsAndCountSigsBeforeStaking(
|
[rpc][availability][apr] Richer validator information, implement APR, unify EPoS computation, remove fall 2019 tech debt (#2484)
* [rpc][validator] Extend hmy blockchain validator information
* [availability] Optimize bump count
* [staking][validator][rpc] Remove validator stats rpc, fold into validator information, make existing pattern default behavior
* [slash] Reimplement SetDifference
* [reward][engine][network] Remove bad API from fall, begin setup for Per validator awards
* [header] Custom Marshal header for downstream, remove dev code
* [effective][committee] Factor out EPoS round of computation thereby unification in codebase of EPoS
* [unit-test] Fix semantically wrong validator unit tests, punt on maxBLS key wrt tx-pool test
* [reward] Use excellent singleflight package for caching lookup of subcommittees
* [apr][reward] Begin APR package itself, iterate on iterface signatures
* [reward] Handle possible error from singleflight
* [rpc][validator][reward] Adjust RPC committees, singleflight on votingPower, foldStats into Validator Information
* [apr] Stub out computation of APR
* [effective][committee] Upgrade SlotPurchase with named fields, provide marshal
* [effective] Update Tests
* [blockchain] TODO Remove the validators no longer in committee
* [validator][effective] More expressive string representation of eligibilty, ValidatorRPC explicit say if in committee now
* [rpc] Median-stake more semantic meaningful
* [validator] Iterate on semantic meaning of JSON representation
* [offchain] Make validator stats return explicit error
* [availability] Small typo
* [rpc] Quick visual hack until fix delete out kicked out validators
* [offchain] Delete validator from offchain that lost their slot
* [apr] Forgot to update interface signature
* [apr] Mul instead of Div
* [protocol][validator] Fold block reward accum per vaidator into validator-wrapper, off-chain => on-chain
* [votepower] Refactor votepower Roster, simplify aggregation of network wide rosters
* [votepower][shard] Adjust roster, optimize usage of BLSPublicKey as key, use MarshalText trick
* [shard] Granular errors
* [votepower][validator] Unify votepower data structure with off-chain usage
* [votepower][consensus][validator] Further simplify and unify votepower with off-chain, validator stats
* [votepower] Use RJs naming convention group,overall
* [votepower] Remove Println, do keep enforcing order
* [effective][reward] Expand semantics of eligibility as it was overloaded and confusing, evict old voting power computations
* [apr] Adjust json field name
* [votepower] Only aggregate on external validator
* [votepower] Mistake on aggregation, custom presentation network-wide
* [rpc][validator][availability] Remove parameter, take into account empty snapshot
* [apr] Use snapshots from two, one epochs ago. Still have question on header
* [apr] Use GetHeaderByNumber for the header needed for time stamp
* [chain] Evict > 3 epoch old voting power
* [blockchain] Leave Delete Validator snapshot as TODO
* [validator][rpc][effective] Undo changes to Protocol field, use virtual construct at RPC layer for meaning
* [project] Address PR comments
* [committee][rpc] Move +1 to computation of epos round rather than hack mutation
* [reward] Remove entire unnecessary loop, hook on AddReward. Remove unnecessary new big int
* [votepower][rpc][validator] Stick with numeric.Dec for token involved with computation, expose accumulate block-reward in RPC
* [effective][committee] Track the candidates for the EPoS auction, RPC median-stake benefits
* [node] Add hack way to get real error reason of why cannot load shardchain
* [consensus] Expand log on current issue on nil block
* [apr] Do the actual call to compute for validator's APR
* [committee] Wrap SlotOrder with validator address, manifests in median-stake RPC
* [apr] Incorrect error handle order
* [quorum] Remove incorrect compare on bls Key, (typo), remove redundant error check
* [shard] Add log if stakedSlots is 0
* [apr] More sanity check on div by zero, more lenient on error when dont have historical data yet
* [committee] Remove + 1 on seat count
* [apr] Use int64() directly
* [apr] Log when odd empty nil header
* [apr] Do not crash on empty header, figure out later
5 years ago
|
|
|
bc engine.ChainReader, state *state.DB,
|
|
|
|
header *block.Header, sigsReady chan bool,
|
|
|
|
) (numeric.Dec, reward.Reader, error) {
|
|
|
|
parentHeader := bc.GetHeaderByHash(header.ParentHash())
|
|
|
|
|
|
|
|
if parentHeader == nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, errors.Errorf(
|
|
|
|
"cannot find parent block header in DB at parent hash %s",
|
|
|
|
header.ParentHash().Hex(),
|
|
|
|
)
|
|
|
|
}
|
|
|
|
if parentHeader.Number().Cmp(common.Big0) == 0 {
|
|
|
|
// Parent is an epoch block,
|
|
|
|
// which is not signed in the usual manner therefore rewards nothing.
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, nil
|
|
|
|
}
|
|
|
|
parentShardState, err := bc.ReadShardState(parentHeader.Epoch())
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), nil, errors.Wrapf(
|
|
|
|
err, "cannot read shard state at epoch %v", parentHeader.Epoch(),
|
|
|
|
)
|
|
|
|
}
|
|
|
|
|
|
|
|
// Block here until the commit sigs are ready or timeout.
|
|
|
|
// sigsReady signal indicates that the commit sigs are already populated in the header object.
|
|
|
|
if err := waitForCommitSigs(sigsReady); err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
|
|
|
|
_, signers, _, err := availability.BallotResult(
|
|
|
|
parentHeader, header, parentShardState, header.ShardID(),
|
|
|
|
)
|
|
|
|
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
|
[rpc][availability][apr] Richer validator information, implement APR, unify EPoS computation, remove fall 2019 tech debt (#2484)
* [rpc][validator] Extend hmy blockchain validator information
* [availability] Optimize bump count
* [staking][validator][rpc] Remove validator stats rpc, fold into validator information, make existing pattern default behavior
* [slash] Reimplement SetDifference
* [reward][engine][network] Remove bad API from fall, begin setup for Per validator awards
* [header] Custom Marshal header for downstream, remove dev code
* [effective][committee] Factor out EPoS round of computation thereby unification in codebase of EPoS
* [unit-test] Fix semantically wrong validator unit tests, punt on maxBLS key wrt tx-pool test
* [reward] Use excellent singleflight package for caching lookup of subcommittees
* [apr][reward] Begin APR package itself, iterate on iterface signatures
* [reward] Handle possible error from singleflight
* [rpc][validator][reward] Adjust RPC committees, singleflight on votingPower, foldStats into Validator Information
* [apr] Stub out computation of APR
* [effective][committee] Upgrade SlotPurchase with named fields, provide marshal
* [effective] Update Tests
* [blockchain] TODO Remove the validators no longer in committee
* [validator][effective] More expressive string representation of eligibilty, ValidatorRPC explicit say if in committee now
* [rpc] Median-stake more semantic meaningful
* [validator] Iterate on semantic meaning of JSON representation
* [offchain] Make validator stats return explicit error
* [availability] Small typo
* [rpc] Quick visual hack until fix delete out kicked out validators
* [offchain] Delete validator from offchain that lost their slot
* [apr] Forgot to update interface signature
* [apr] Mul instead of Div
* [protocol][validator] Fold block reward accum per vaidator into validator-wrapper, off-chain => on-chain
* [votepower] Refactor votepower Roster, simplify aggregation of network wide rosters
* [votepower][shard] Adjust roster, optimize usage of BLSPublicKey as key, use MarshalText trick
* [shard] Granular errors
* [votepower][validator] Unify votepower data structure with off-chain usage
* [votepower][consensus][validator] Further simplify and unify votepower with off-chain, validator stats
* [votepower] Use RJs naming convention group,overall
* [votepower] Remove Println, do keep enforcing order
* [effective][reward] Expand semantics of eligibility as it was overloaded and confusing, evict old voting power computations
* [apr] Adjust json field name
* [votepower] Only aggregate on external validator
* [votepower] Mistake on aggregation, custom presentation network-wide
* [rpc][validator][availability] Remove parameter, take into account empty snapshot
* [apr] Use snapshots from two, one epochs ago. Still have question on header
* [apr] Use GetHeaderByNumber for the header needed for time stamp
* [chain] Evict > 3 epoch old voting power
* [blockchain] Leave Delete Validator snapshot as TODO
* [validator][rpc][effective] Undo changes to Protocol field, use virtual construct at RPC layer for meaning
* [project] Address PR comments
* [committee][rpc] Move +1 to computation of epos round rather than hack mutation
* [reward] Remove entire unnecessary loop, hook on AddReward. Remove unnecessary new big int
* [votepower][rpc][validator] Stick with numeric.Dec for token involved with computation, expose accumulate block-reward in RPC
* [effective][committee] Track the candidates for the EPoS auction, RPC median-stake benefits
* [node] Add hack way to get real error reason of why cannot load shardchain
* [consensus] Expand log on current issue on nil block
* [apr] Do the actual call to compute for validator's APR
* [committee] Wrap SlotOrder with validator address, manifests in median-stake RPC
* [apr] Incorrect error handle order
* [quorum] Remove incorrect compare on bls Key, (typo), remove redundant error check
* [shard] Add log if stakedSlots is 0
* [apr] More sanity check on div by zero, more lenient on error when dont have historical data yet
* [committee] Remove + 1 on seat count
* [apr] Use int64() directly
* [apr] Log when odd empty nil header
* [apr] Do not crash on empty header, figure out later
5 years ago
|
|
|
totalAmount := big.NewInt(0)
|
|
|
|
|
|
|
|
{
|
|
|
|
last := big.NewInt(0)
|
|
|
|
count := big.NewInt(int64(len(signers)))
|
|
|
|
for i, account := range signers {
|
|
|
|
cur := big.NewInt(0)
|
|
|
|
cur.Mul(stakingReward.PreStakedBlocks, big.NewInt(int64(i+1))).Div(cur, count)
|
[rpc][availability][apr] Richer validator information, implement APR, unify EPoS computation, remove fall 2019 tech debt (#2484)
* [rpc][validator] Extend hmy blockchain validator information
* [availability] Optimize bump count
* [staking][validator][rpc] Remove validator stats rpc, fold into validator information, make existing pattern default behavior
* [slash] Reimplement SetDifference
* [reward][engine][network] Remove bad API from fall, begin setup for Per validator awards
* [header] Custom Marshal header for downstream, remove dev code
* [effective][committee] Factor out EPoS round of computation thereby unification in codebase of EPoS
* [unit-test] Fix semantically wrong validator unit tests, punt on maxBLS key wrt tx-pool test
* [reward] Use excellent singleflight package for caching lookup of subcommittees
* [apr][reward] Begin APR package itself, iterate on iterface signatures
* [reward] Handle possible error from singleflight
* [rpc][validator][reward] Adjust RPC committees, singleflight on votingPower, foldStats into Validator Information
* [apr] Stub out computation of APR
* [effective][committee] Upgrade SlotPurchase with named fields, provide marshal
* [effective] Update Tests
* [blockchain] TODO Remove the validators no longer in committee
* [validator][effective] More expressive string representation of eligibilty, ValidatorRPC explicit say if in committee now
* [rpc] Median-stake more semantic meaningful
* [validator] Iterate on semantic meaning of JSON representation
* [offchain] Make validator stats return explicit error
* [availability] Small typo
* [rpc] Quick visual hack until fix delete out kicked out validators
* [offchain] Delete validator from offchain that lost their slot
* [apr] Forgot to update interface signature
* [apr] Mul instead of Div
* [protocol][validator] Fold block reward accum per vaidator into validator-wrapper, off-chain => on-chain
* [votepower] Refactor votepower Roster, simplify aggregation of network wide rosters
* [votepower][shard] Adjust roster, optimize usage of BLSPublicKey as key, use MarshalText trick
* [shard] Granular errors
* [votepower][validator] Unify votepower data structure with off-chain usage
* [votepower][consensus][validator] Further simplify and unify votepower with off-chain, validator stats
* [votepower] Use RJs naming convention group,overall
* [votepower] Remove Println, do keep enforcing order
* [effective][reward] Expand semantics of eligibility as it was overloaded and confusing, evict old voting power computations
* [apr] Adjust json field name
* [votepower] Only aggregate on external validator
* [votepower] Mistake on aggregation, custom presentation network-wide
* [rpc][validator][availability] Remove parameter, take into account empty snapshot
* [apr] Use snapshots from two, one epochs ago. Still have question on header
* [apr] Use GetHeaderByNumber for the header needed for time stamp
* [chain] Evict > 3 epoch old voting power
* [blockchain] Leave Delete Validator snapshot as TODO
* [validator][rpc][effective] Undo changes to Protocol field, use virtual construct at RPC layer for meaning
* [project] Address PR comments
* [committee][rpc] Move +1 to computation of epos round rather than hack mutation
* [reward] Remove entire unnecessary loop, hook on AddReward. Remove unnecessary new big int
* [votepower][rpc][validator] Stick with numeric.Dec for token involved with computation, expose accumulate block-reward in RPC
* [effective][committee] Track the candidates for the EPoS auction, RPC median-stake benefits
* [node] Add hack way to get real error reason of why cannot load shardchain
* [consensus] Expand log on current issue on nil block
* [apr] Do the actual call to compute for validator's APR
* [committee] Wrap SlotOrder with validator address, manifests in median-stake RPC
* [apr] Incorrect error handle order
* [quorum] Remove incorrect compare on bls Key, (typo), remove redundant error check
* [shard] Add log if stakedSlots is 0
* [apr] More sanity check on div by zero, more lenient on error when dont have historical data yet
* [committee] Remove + 1 on seat count
* [apr] Use int64() directly
* [apr] Log when odd empty nil header
* [apr] Do not crash on empty header, figure out later
5 years ago
|
|
|
diff := big.NewInt(0).Sub(cur, last)
|
|
|
|
state.AddBalance(account.EcdsaAddress, diff)
|
|
|
|
totalAmount.Add(totalAmount, diff)
|
|
|
|
last = cur
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
if totalAmount.Cmp(stakingReward.PreStakedBlocks) != 0 {
|
|
|
|
utils.Logger().Error().
|
|
|
|
Int64("block-reward", stakingReward.PreStakedBlocks.Int64()).
|
|
|
|
Int64("total-amount-paid-out", totalAmount.Int64()).
|
|
|
|
Msg("Total paid out was not equal to block-reward")
|
|
|
|
return numeric.ZeroDec(), nil, errors.Wrapf(
|
|
|
|
network.ErrPayoutNotEqualBlockReward, "payout "+totalAmount.String(),
|
|
|
|
)
|
|
|
|
}
|
|
|
|
|
|
|
|
return numeric.ZeroDec(), network.NewPreStakingEraRewarded(totalAmount), nil
|
|
|
|
}
|
|
|
|
|
|
|
|
// getDefaultStakingReward returns the static default reward based on the the block production interval and the chain.
|
|
|
|
func getDefaultStakingReward(bc engine.ChainReader, epoch *big.Int, blockNum uint64) numeric.Dec {
|
|
|
|
defaultReward := stakingReward.StakedBlocks
|
|
|
|
|
|
|
|
// the block reward is adjusted accordingly based on 5s and 3s block time forks
|
|
|
|
if bc.Config().ChainID == params.TestnetChainID && bc.Config().FiveSecondsEpoch.Cmp(big.NewInt(16500)) == 0 {
|
|
|
|
// Testnet:
|
|
|
|
// This is testnet requiring the one-off forking logic
|
|
|
|
if blockNum > 634644 {
|
|
|
|
defaultReward = stakingReward.FiveSecStakedBlocks
|
|
|
|
if blockNum > 636507 {
|
|
|
|
defaultReward = stakingReward.StakedBlocks
|
|
|
|
if blockNum > 639341 {
|
|
|
|
defaultReward = stakingReward.FiveSecStakedBlocks
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
if bc.Config().IsTwoSeconds(epoch) {
|
|
|
|
defaultReward = stakingReward.TwoSecStakedBlocks
|
|
|
|
}
|
|
|
|
} else {
|
|
|
|
// Mainnet (other nets):
|
|
|
|
if bc.Config().IsTwoSeconds(epoch) {
|
|
|
|
defaultReward = stakingReward.TwoSecStakedBlocks
|
|
|
|
} else if bc.Config().IsFiveSeconds(epoch) {
|
|
|
|
defaultReward = stakingReward.FiveSecStakedBlocks
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
return defaultReward
|
|
|
|
}
|
|
|
|
|
|
|
|
// AccumulateRewardsAndCountSigs credits the coinbase of the given block with the mining reward and
|
|
|
|
// also does IncrementValidatorSigningCounts for validators.
|
|
|
|
// param sigsReady: Signal indicating that commit sigs are already populated in the header object.
|
|
|
|
func AccumulateRewardsAndCountSigs(
|
|
|
|
bc engine.ChainReader, state *state.DB,
|
|
|
|
header *block.Header, beaconChain engine.ChainReader, sigsReady chan bool,
|
|
|
|
) (numeric.Dec, reward.Reader, error) {
|
|
|
|
blockNum := header.Number().Uint64()
|
|
|
|
epoch := header.Epoch()
|
|
|
|
isBeaconChain := bc.CurrentHeader().ShardID() == shard.BeaconChainShardID
|
|
|
|
|
|
|
|
if blockNum == 0 {
|
|
|
|
err := waitForCommitSigs(sigsReady) // wait for commit signatures, or timeout and return err.
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
|
|
|
|
// Pre-staking era
|
|
|
|
if !bc.Config().IsStaking(epoch) {
|
|
|
|
return accumulateRewardsAndCountSigsBeforeStaking(bc, state, header, sigsReady)
|
|
|
|
}
|
|
|
|
|
|
|
|
// Rewards are accumulated only in the beaconchain, so just wait for commit sigs and return.
|
|
|
|
if !isBeaconChain {
|
|
|
|
err := waitForCommitSigs(sigsReady)
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
|
|
|
|
defaultReward := getDefaultStakingReward(bc, epoch, blockNum)
|
|
|
|
if defaultReward.IsNegative() { // TODO: Figure out whether that's possible.
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, nil
|
|
|
|
}
|
|
|
|
|
|
|
|
// Handle rewards on pre-aggregated rewards era.
|
|
|
|
if !bc.Config().IsAggregatedRewardEpoch(header.Epoch()) {
|
|
|
|
return distributeRewardBeforeAggregateEpoch(bc, state, header, beaconChain, defaultReward, sigsReady)
|
|
|
|
}
|
|
|
|
|
|
|
|
// Aggregated Rewards Era: Rewards are aggregated every 64 blocks.
|
|
|
|
|
|
|
|
// Wait for commit signatures, or timeout and return err.
|
|
|
|
if err := waitForCommitSigs(sigsReady); err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
|
|
|
|
// Only do reward distribution at the 63th block in the modulus.
|
|
|
|
if blockNum%RewardFrequency != RewardFrequency-1 {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, nil
|
|
|
|
}
|
|
|
|
|
|
|
|
return distributeRewardAfterAggregateEpoch(bc, state, header, beaconChain, defaultReward)
|
|
|
|
}
|
|
|
|
|
|
|
|
func waitForCommitSigs(sigsReady chan bool) error {
|
|
|
|
select {
|
|
|
|
case success := <-sigsReady:
|
|
|
|
if !success {
|
|
|
|
return errors.New("Failed to get commit sigs")
|
|
|
|
}
|
|
|
|
utils.Logger().Info().Msg("Commit sigs are ready")
|
|
|
|
case <-time.After(AsyncBlockProposalTimeout):
|
|
|
|
return errors.New("Timeout waiting for commit sigs for reward calculation")
|
|
|
|
}
|
|
|
|
return nil
|
|
|
|
}
|
|
|
|
|
|
|
|
func distributeRewardAfterAggregateEpoch(bc engine.ChainReader, state *state.DB, header *block.Header, beaconChain engine.ChainReader,
|
|
|
|
rewardToDistribute numeric.Dec) (numeric.Dec, reward.Reader, error) {
|
|
|
|
epoch := header.Epoch()
|
|
|
|
defaultReward := rewardToDistribute
|
|
|
|
remainingReward := numeric.ZeroDec()
|
|
|
|
if bc.Config().IsHIP30(epoch) {
|
|
|
|
fractionToRecovery := shard.Schedule.InstanceForEpoch(epoch).HIP30EmissionFraction()
|
|
|
|
fractionToValidators := numeric.OneDec().Sub(fractionToRecovery)
|
|
|
|
defaultReward = rewardToDistribute.Mul(fractionToValidators)
|
|
|
|
remainingReward = rewardToDistribute.Mul(fractionToRecovery)
|
|
|
|
}
|
|
|
|
newRewards, payouts :=
|
|
|
|
big.NewInt(0), []reward.Payout{}
|
|
|
|
|
|
|
|
allPayables := []slotPayable{}
|
|
|
|
curBlockNum := header.Number().Uint64()
|
|
|
|
|
|
|
|
allCrossLinks := types.CrossLinks{}
|
|
|
|
startTime := time.Now()
|
|
|
|
// loop through [0...63] position in the modulus index of the 64 blocks
|
|
|
|
// Note the current block is at position 63 of the modulus.
|
|
|
|
for i := curBlockNum - RewardFrequency + 1; i <= curBlockNum; i++ {
|
|
|
|
if i < 0 {
|
|
|
|
continue
|
|
|
|
}
|
|
|
|
|
|
|
|
var curHeader *block.Header
|
|
|
|
if i == curBlockNum {
|
|
|
|
// When it's the current block (63th), we should use the provided header since it's not written in db yet.
|
|
|
|
curHeader = header
|
|
|
|
} else {
|
|
|
|
curHeader = bc.GetHeaderByNumber(i)
|
|
|
|
}
|
|
|
|
|
|
|
|
// Put shard 0 signatures as a crosslink for easy and consistent processing as other shards' crosslinks
|
|
|
|
allCrossLinks = append(allCrossLinks, *types.NewCrossLink(curHeader, bc.GetHeaderByHash(curHeader.ParentHash())))
|
|
|
|
|
|
|
|
// Put the real crosslinks in the list
|
|
|
|
if cxLinks := curHeader.CrossLinks(); len(cxLinks) > 0 {
|
|
|
|
crossLinks := types.CrossLinks{}
|
|
|
|
if err := rlp.DecodeBytes(cxLinks, &crossLinks); err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
allCrossLinks = append(allCrossLinks, crossLinks...)
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
for i := range allCrossLinks {
|
|
|
|
cxLink := allCrossLinks[i]
|
|
|
|
if !bc.Config().IsStaking(cxLink.Epoch()) {
|
|
|
|
continue
|
|
|
|
}
|
|
|
|
utils.Logger().Info().Msg(fmt.Sprintf("allCrossLinks shard %d block %d", cxLink.ShardID(), cxLink.BlockNum()))
|
|
|
|
payables, _, err := processOneCrossLink(bc, state, cxLink, defaultReward, i)
|
|
|
|
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
|
|
|
|
allPayables = append(allPayables, payables...)
|
|
|
|
}
|
|
|
|
|
|
|
|
// Aggregate all the rewards for each validator
|
|
|
|
allValidatorPayable := map[common.Address]*big.Int{}
|
|
|
|
allAddresses := []common.Address{}
|
|
|
|
for _, payThem := range allPayables {
|
|
|
|
if _, ok := allValidatorPayable[payThem.EcdsaAddress]; !ok {
|
|
|
|
allValidatorPayable[payThem.EcdsaAddress] = big.NewInt(0).SetBytes(payThem.payout.Bytes())
|
|
|
|
} else {
|
|
|
|
allValidatorPayable[payThem.EcdsaAddress] = big.NewInt(0).Add(allValidatorPayable[payThem.EcdsaAddress], payThem.payout)
|
|
|
|
}
|
|
|
|
|
|
|
|
payouts = append(payouts, reward.Payout{
|
|
|
|
Addr: payThem.EcdsaAddress,
|
|
|
|
NewlyEarned: payThem.payout,
|
|
|
|
EarningKey: payThem.BLSPublicKey,
|
|
|
|
})
|
|
|
|
}
|
|
|
|
|
|
|
|
for addr, _ := range allValidatorPayable {
|
|
|
|
allAddresses = append(allAddresses, addr)
|
|
|
|
}
|
|
|
|
|
|
|
|
// always sort validators by address before rewarding
|
|
|
|
sort.SliceStable(allAddresses,
|
|
|
|
func(i, j int) bool {
|
|
|
|
return bytes.Compare(allAddresses[i][:], allAddresses[j][:]) < 0
|
|
|
|
},
|
|
|
|
)
|
|
|
|
|
|
|
|
// Finally do the pay
|
|
|
|
startTimeLocal := time.Now()
|
|
|
|
for _, addr := range allAddresses {
|
|
|
|
snapshot, err := bc.ReadValidatorSnapshot(addr)
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
due := allValidatorPayable[addr]
|
|
|
|
newRewards.Add(newRewards, due)
|
|
|
|
|
|
|
|
shares, err := lookupDelegatorShares(snapshot)
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
if err := state.AddReward(snapshot.Validator, due, shares); err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
}
|
|
|
|
utils.Logger().Debug().Int64("elapsed time", time.Now().Sub(startTimeLocal).Milliseconds()).Msg("After Chain Reward (AddReward)")
|
|
|
|
utils.Logger().Debug().Int64("elapsed time", time.Now().Sub(startTime).Milliseconds()).Msg("After Chain Reward")
|
|
|
|
|
|
|
|
return remainingReward, network.NewStakingEraRewardForRound(
|
|
|
|
newRewards, payouts,
|
|
|
|
), nil
|
|
|
|
}
|
|
|
|
|
|
|
|
func distributeRewardBeforeAggregateEpoch(bc engine.ChainReader, state *state.DB, header *block.Header, beaconChain engine.ChainReader,
|
|
|
|
defaultReward numeric.Dec, sigsReady chan bool) (numeric.Dec, reward.Reader, error) {
|
|
|
|
newRewards, payouts :=
|
|
|
|
big.NewInt(0), []reward.Payout{}
|
|
|
|
|
|
|
|
allPayables := []slotPayable{}
|
|
|
|
if cxLinks := header.CrossLinks(); len(cxLinks) > 0 {
|
|
|
|
|
|
|
|
startTime := time.Now()
|
|
|
|
crossLinks := types.CrossLinks{}
|
|
|
|
if err := rlp.DecodeBytes(cxLinks, &crossLinks); err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
utils.Logger().Debug().Int64("elapsed time", time.Now().Sub(startTime).Milliseconds()).Msg("Decode Cross Links")
|
|
|
|
|
|
|
|
startTime = time.Now()
|
|
|
|
for i := range crossLinks {
|
|
|
|
cxLink := crossLinks[i]
|
|
|
|
payables, _, err := processOneCrossLink(bc, state, cxLink, defaultReward, i)
|
|
|
|
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
|
|
|
|
allPayables = append(allPayables, payables...)
|
|
|
|
}
|
|
|
|
|
|
|
|
resultsHandle := make([][]slotPayable, len(crossLinks))
|
|
|
|
for i := range resultsHandle {
|
|
|
|
resultsHandle[i] = []slotPayable{}
|
|
|
|
}
|
|
|
|
|
|
|
|
for _, payThem := range allPayables {
|
|
|
|
bucket := payThem.bucket
|
|
|
|
resultsHandle[bucket] = append(resultsHandle[bucket], payThem)
|
|
|
|
}
|
|
|
|
|
|
|
|
// Check if any errors and sort each bucket to enforce order
|
|
|
|
for bucket := range resultsHandle {
|
|
|
|
sort.SliceStable(resultsHandle[bucket],
|
|
|
|
func(i, j int) bool {
|
|
|
|
return resultsHandle[bucket][i].index < resultsHandle[bucket][j].index
|
|
|
|
},
|
|
|
|
)
|
|
|
|
}
|
|
|
|
|
|
|
|
// Finally do the pay
|
|
|
|
startTimeLocal := time.Now()
|
|
|
|
for bucket := range resultsHandle {
|
|
|
|
for payThem := range resultsHandle[bucket] {
|
|
|
|
payable := resultsHandle[bucket][payThem]
|
|
|
|
snapshot, err := bc.ReadValidatorSnapshot(
|
|
|
|
payable.EcdsaAddress,
|
|
|
|
)
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
due := resultsHandle[bucket][payThem].payout
|
|
|
|
newRewards.Add(newRewards, due)
|
|
|
|
|
|
|
|
shares, err := lookupDelegatorShares(snapshot)
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
if err := state.AddReward(snapshot.Validator, due, shares); err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
payouts = append(payouts, reward.Payout{
|
|
|
|
Addr: payable.EcdsaAddress,
|
|
|
|
NewlyEarned: due,
|
|
|
|
EarningKey: payable.BLSPublicKey,
|
|
|
|
})
|
|
|
|
}
|
|
|
|
}
|
|
|
|
utils.Logger().Debug().Int64("elapsed time", time.Now().Sub(startTimeLocal).Milliseconds()).Msg("Shard Chain Reward (AddReward)")
|
|
|
|
utils.Logger().Debug().Int64("elapsed time", time.Now().Sub(startTime).Milliseconds()).Msg("Shard Chain Reward")
|
|
|
|
}
|
|
|
|
|
|
|
|
// Block here until the commit sigs are ready or timeout.
|
|
|
|
// sigsReady signal indicates that the commit sigs are already populated in the header object.
|
|
|
|
if err := waitForCommitSigs(sigsReady); err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
|
|
|
|
startTime := time.Now()
|
|
|
|
// Take care of my own beacon chain committee, _ is missing, for slashing
|
|
|
|
parentE, members, payable, missing, err := ballotResultBeaconchain(beaconChain, header)
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, errors.Wrapf(err, "shard 0 block %d reward error with bitmap %x", header.Number(), header.LastCommitBitmap())
|
|
|
|
}
|
|
|
|
subComm := shard.Committee{ShardID: shard.BeaconChainShardID, Slots: members}
|
|
|
|
|
|
|
|
if err := availability.IncrementValidatorSigningCounts(
|
|
|
|
beaconChain,
|
|
|
|
subComm.StakedValidators(),
|
|
|
|
state,
|
|
|
|
payable,
|
|
|
|
missing,
|
|
|
|
); err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
votingPower, err := lookupVotingPower(
|
|
|
|
parentE, &subComm,
|
|
|
|
)
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
|
|
|
|
allSignersShare := numeric.ZeroDec()
|
|
|
|
for j := range payable {
|
|
|
|
voter := votingPower.Voters[payable[j].BLSPublicKey]
|
|
|
|
if !voter.IsHarmonyNode {
|
|
|
|
voterShare := voter.OverallPercent
|
|
|
|
allSignersShare = allSignersShare.Add(voterShare)
|
|
|
|
}
|
|
|
|
}
|
|
|
|
for beaconMember := range payable {
|
|
|
|
blsKey := payable[beaconMember].BLSPublicKey
|
|
|
|
voter := votingPower.Voters[blsKey]
|
|
|
|
if !voter.IsHarmonyNode {
|
|
|
|
snapshot, err := bc.ReadValidatorSnapshot(voter.EarningAccount)
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
due := defaultReward.Mul(
|
|
|
|
voter.OverallPercent.Quo(allSignersShare),
|
|
|
|
).RoundInt()
|
|
|
|
newRewards.Add(newRewards, due)
|
|
|
|
|
|
|
|
shares, err := lookupDelegatorShares(snapshot)
|
|
|
|
if err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
if err := state.AddReward(snapshot.Validator, due, shares); err != nil {
|
|
|
|
return numeric.ZeroDec(), network.EmptyPayout, err
|
|
|
|
}
|
|
|
|
payouts = append(payouts, reward.Payout{
|
|
|
|
Addr: voter.EarningAccount,
|
|
|
|
NewlyEarned: due,
|
|
|
|
EarningKey: voter.Identity,
|
|
|
|
})
|
|
|
|
}
|
|
|
|
}
|
|
|
|
utils.Logger().Debug().Int64("elapsed time", time.Now().Sub(startTime).Milliseconds()).Msg("Beacon Chain Reward")
|
|
|
|
|
|
|
|
return numeric.ZeroDec(), network.NewStakingEraRewardForRound(
|
|
|
|
newRewards, payouts,
|
|
|
|
), nil
|
|
|
|
}
|
|
|
|
|
|
|
|
func processOneCrossLink(bc engine.ChainReader, state *state.DB, cxLink types.CrossLink, defaultReward numeric.Dec, bucket int) ([]slotPayable, []slotMissing, error) {
|
|
|
|
epoch, shardID := cxLink.Epoch(), cxLink.ShardID()
|
|
|
|
if !bc.Config().IsStaking(epoch) {
|
|
|
|
return nil, nil, nil
|
|
|
|
}
|
|
|
|
startTimeLocal := time.Now()
|
|
|
|
shardState, err := bc.ReadShardState(epoch)
|
|
|
|
utils.Logger().Debug().Int64("elapsed time", time.Now().Sub(startTimeLocal).Milliseconds()).Msg("Shard Chain Reward (ReadShardState)")
|
|
|
|
|
|
|
|
if err != nil {
|
|
|
|
return nil, nil, err
|
|
|
|
}
|
|
|
|
|
|
|
|
subComm, err := shardState.FindCommitteeByID(shardID)
|
|
|
|
if err != nil {
|
|
|
|
return nil, nil, err
|
|
|
|
}
|
|
|
|
|
|
|
|
startTimeLocal = time.Now()
|
|
|
|
payableSigners, missing, err := availability.BlockSigners(
|
|
|
|
cxLink.Bitmap(), subComm,
|
|
|
|
)
|
|
|
|
utils.Logger().Debug().Int64("elapsed time", time.Now().Sub(startTimeLocal).Milliseconds()).Msg("Shard Chain Reward (BlockSigners)")
|
|
|
|
|
|
|
|
if err != nil {
|
|
|
|
return nil, nil, errors.Wrapf(err, "shard %d block %d reward error with bitmap %x", shardID, cxLink.BlockNum(), cxLink.Bitmap())
|
|
|
|
}
|
|
|
|
|
|
|
|
staked := subComm.StakedValidators()
|
|
|
|
startTimeLocal = time.Now()
|
|
|
|
if err := availability.IncrementValidatorSigningCounts(
|
|
|
|
bc, staked, state, payableSigners, missing,
|
|
|
|
); err != nil {
|
|
|
|
return nil, nil, err
|
|
|
|
}
|
|
|
|
utils.Logger().Debug().Int64("elapsed time", time.Now().Sub(startTimeLocal).Milliseconds()).Msg("Shard Chain Reward (IncrementValidatorSigningCounts)")
|
|
|
|
|
|
|
|
startTimeLocal = time.Now()
|
|
|
|
votingPower, err := lookupVotingPower(
|
|
|
|
epoch, subComm,
|
|
|
|
)
|
|
|
|
utils.Logger().Debug().Int64("elapsed time", time.Now().Sub(startTimeLocal).Milliseconds()).Msg("Shard Chain Reward (lookupVotingPower)")
|
|
|
|
|
|
|
|
if err != nil {
|
|
|
|
return nil, nil, err
|
|
|
|
}
|
|
|
|
|
|
|
|
allSignersShare := numeric.ZeroDec()
|
|
|
|
for j := range payableSigners {
|
|
|
|
voter := votingPower.Voters[payableSigners[j].BLSPublicKey]
|
|
|
|
if !voter.IsHarmonyNode {
|
|
|
|
voterShare := voter.OverallPercent
|
|
|
|
allSignersShare = allSignersShare.Add(voterShare)
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
allPayables, allMissing := []slotPayable{}, []slotMissing{}
|
|
|
|
startTimeLocal = time.Now()
|
|
|
|
for j := range payableSigners {
|
|
|
|
voter := votingPower.Voters[payableSigners[j].BLSPublicKey]
|
|
|
|
if !voter.IsHarmonyNode && !voter.OverallPercent.IsZero() {
|
|
|
|
due := defaultReward.Mul(
|
|
|
|
voter.OverallPercent.Quo(allSignersShare),
|
|
|
|
)
|
|
|
|
allPayables = append(allPayables, slotPayable{
|
|
|
|
Slot: payableSigners[j],
|
|
|
|
payout: due.TruncateInt(),
|
|
|
|
bucket: bucket,
|
|
|
|
index: j,
|
|
|
|
shardID: shardID,
|
|
|
|
})
|
|
|
|
}
|
|
|
|
}
|
|
|
|
utils.Logger().Debug().Int64("elapsed time", time.Now().Sub(startTimeLocal).Milliseconds()).Msg("Shard Chain Reward (allPayables)")
|
|
|
|
|
|
|
|
for j := range missing {
|
|
|
|
allMissing = append(allMissing, slotMissing{
|
|
|
|
Slot: missing[j],
|
|
|
|
bucket: bucket,
|
|
|
|
index: j,
|
|
|
|
})
|
|
|
|
}
|
|
|
|
return allPayables, allMissing, nil
|
|
|
|
}
|